C20H20F2O2 — CID 142835435
1-[2-[(2,4-difluorophenyl)methoxy]-5-methylphenyl]-4-methylpent-4-en-1-one (PubChem CID 142835435) has the molecular formula C20H20F2O2 and a molecular weight of 330.37 g/mol. Its IUPAC name is 1-[2-[(2,4-difluorophenyl)methoxy]-5-methylphenyl]-4-methylpent-4-en-1-one.
| Compound Name | 1-[2-[(2,4-difluorophenyl)methoxy]-5-methylphenyl]-4-methylpent-4-en-1-one |
|---|---|
| PubChem CID | 142835435 |
| Molecular Formula | C20H20F2O2 |
| Molecular Weight | 330.37 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | 1-[2-[(2,4-difluorophenyl)methoxy]-5-methylphenyl]-4-methylpent-4-en-1-one |
| SMILES | C=C(C)CCC(=O)c1cc(C)ccc1OCc1ccc(F)cc1F |
| InChI | InChI=1S/C20H20F2O2/c1-13(2)4-8-19(23)17-10-14(3)5-9-20(17)24-12-15-6-7-16(21)11-18(15)22/h5-7,9-11H,1,4,8,12H2,2-3H3 |
| InChIKey | GMRHMMMOWNKSNN-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.37 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|