C18H17FO4 — CID 82051889
4-[2-[(4-fluorophenyl)methoxy]-5-methylphenyl]-4-oxobutanoic acid (PubChem CID 82051889) has the molecular formula C18H17FO4 and a molecular weight of 316.33 g/mol. Its IUPAC name is 4-[2-[(4-fluorophenyl)methoxy]-5-methylphenyl]-4-oxobutanoic acid.
| Compound Name | 4-[2-[(4-fluorophenyl)methoxy]-5-methylphenyl]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 82051889 |
| Molecular Formula | C18H17FO4 |
| Molecular Weight | 316.33 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | 4-[2-[(4-fluorophenyl)methoxy]-5-methylphenyl]-4-oxobutanoic acid |
| SMILES | Cc1ccc(OCc2ccc(F)cc2)c(C(=O)CCC(=O)O)c1 |
| InChI | InChI=1S/C18H17FO4/c1-12-2-8-17(15(10-12)16(20)7-9-18(21)22)23-11-13-3-5-14(19)6-4-13/h2-6,8,10H,7,9,11H2,1H3,(H,21,22) |
| InChIKey | UNQDDWIYRGRXTR-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.33 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |