C34H40BBrN2O10 — CID 159293086
1-O-tert-butyl 2-O-methyl 3-bromopyrrole-1,2-dicarboxylate;1-O-tert-butyl 2-O-methyl 3-phenylpyrrole-1,2-dicarboxylate;phenylboronic acid (PubChem CID 159293086) has the molecular formula C34H40BBrN2O10 and a molecular weight of 727.41 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-methyl 3-bromopyrrole-1,2-dicarboxylate;1-O-tert-butyl 2-O-methyl 3-phenylpyrrole-1,2-dicarboxylate;phenylboronic acid.
| Compound Name | 1-O-tert-butyl 2-O-methyl 3-bromopyrrole-1,2-dicarboxylate;1-O-tert-butyl 2-O-methyl 3-phenylpyrrole-1,2-dicarboxylate;phenylboronic acid |
|---|---|
| PubChem CID | 159293086 |
| Molecular Formula | C34H40BBrN2O10 |
| Molecular Weight | 727.41 g/mol |
| Exact Mass | 726.20 |
| IUPAC Name | 1-O-tert-butyl 2-O-methyl 3-bromopyrrole-1,2-dicarboxylate;1-O-tert-butyl 2-O-methyl 3-phenylpyrrole-1,2-dicarboxylate;phenylboronic acid |
| SMILES | COC(=O)c1c(-c2ccccc2)ccn1C(=O)OC(C)(C)C.COC(=O)c1c(Br)ccn1C(=O)OC(C)(C)C.OB(O)c1ccccc1 |
| InChI | InChI=1S/C17H19NO4.C11H14BrNO4.C6H7BO2/c1-17(2,3)22-16(20)18-11-10-13(14(18)15(19)21-4)12-8-6-5-7-9-12;1-11(2,3)17-10(15)13-6-5-7(12)8(13)9(14)16-4;8-7(9)6-4-2-1-3-5-6/h5-11H,1-4H3;5-6H,1-4H3;1-5,8-9H |
| InChIKey | LAJHSSLQHHZOKS-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 155.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.41 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|