C23H21ClN2O3 — CID 159296475
(1-ethylbenzimidazol-5-yl)methyl 2-[5-(4-chlorophenyl)-2-methylfuran-3-yl]acetate (PubChem CID 159296475) has the molecular formula C23H21ClN2O3 and a molecular weight of 408.89 g/mol. Its IUPAC name is (1-ethylbenzimidazol-5-yl)methyl 2-[5-(4-chlorophenyl)-2-methylfuran-3-yl]acetate.
| Compound Name | (1-ethylbenzimidazol-5-yl)methyl 2-[5-(4-chlorophenyl)-2-methylfuran-3-yl]acetate |
|---|---|
| PubChem CID | 159296475 |
| Molecular Formula | C23H21ClN2O3 |
| Molecular Weight | 408.89 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | (1-ethylbenzimidazol-5-yl)methyl 2-[5-(4-chlorophenyl)-2-methylfuran-3-yl]acetate |
| SMILES | CCn1cnc2cc(COC(=O)Cc3cc(-c4ccc(Cl)cc4)oc3C)ccc21 |
| InChI | InChI=1S/C23H21ClN2O3/c1-3-26-14-25-20-10-16(4-9-21(20)26)13-28-23(27)12-18-11-22(29-15(18)2)17-5-7-19(24)8-6-17/h4-11,14H,3,12-13H2,1-2H3 |
| InChIKey | LAUBESYITPZRLR-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 57.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.89 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |