C22H19ClN2O3 — CID 158602904
(1-ethylbenzimidazol-5-yl)methyl 2-[5-(4-chlorophenyl)furan-2-yl]acetate (PubChem CID 158602904) has the molecular formula C22H19ClN2O3 and a molecular weight of 394.86 g/mol. Its IUPAC name is (1-ethylbenzimidazol-5-yl)methyl 2-[5-(4-chlorophenyl)furan-2-yl]acetate.
| Compound Name | (1-ethylbenzimidazol-5-yl)methyl 2-[5-(4-chlorophenyl)furan-2-yl]acetate |
|---|---|
| PubChem CID | 158602904 |
| Molecular Formula | C22H19ClN2O3 |
| Molecular Weight | 394.86 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | (1-ethylbenzimidazol-5-yl)methyl 2-[5-(4-chlorophenyl)furan-2-yl]acetate |
| SMILES | CCn1cnc2cc(COC(=O)Cc3ccc(-c4ccc(Cl)cc4)o3)ccc21 |
| InChI | InChI=1S/C22H19ClN2O3/c1-2-25-14-24-19-11-15(3-9-20(19)25)13-27-22(26)12-18-8-10-21(28-18)16-4-6-17(23)7-5-16/h3-11,14H,2,12-13H2,1H3 |
| InChIKey | HVWASSWVBHTZGE-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 57.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.86 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |