C21H19ClN4O2 — CID 9203744
N-[[5-(4-chlorophenyl)furan-2-yl]methyl]-1-ethyl-N-methylbenzotriazole-5-carboxamide (PubChem CID 9203744) has the molecular formula C21H19ClN4O2 and a molecular weight of 394.86 g/mol. Its IUPAC name is N-[[5-(4-chlorophenyl)furan-2-yl]methyl]-1-ethyl-N-methylbenzotriazole-5-carboxamide.
| Compound Name | N-[[5-(4-chlorophenyl)furan-2-yl]methyl]-1-ethyl-N-methylbenzotriazole-5-carboxamide |
|---|---|
| PubChem CID | 9203744 |
| Molecular Formula | C21H19ClN4O2 |
| Molecular Weight | 394.86 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | N-[[5-(4-chlorophenyl)furan-2-yl]methyl]-1-ethyl-N-methylbenzotriazole-5-carboxamide |
| SMILES | CCn1nnc2cc(C(=O)N(C)Cc3ccc(-c4ccc(Cl)cc4)o3)ccc21 |
| InChI | InChI=1S/C21H19ClN4O2/c1-3-26-19-10-6-15(12-18(19)23-24-26)21(27)25(2)13-17-9-11-20(28-17)14-4-7-16(22)8-5-14/h4-12H,3,13H2,1-2H3 |
| InChIKey | WMDJJIPNINMTIR-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 64.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.86 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |