C18H17F3N4O2 — CID 38075234
1-ethyl-N-methyl-N-[[2-(trifluoromethoxy)phenyl]methyl]benzotriazole-5-carboxamide (PubChem CID 38075234) has the molecular formula C18H17F3N4O2 and a molecular weight of 378.35 g/mol. Its IUPAC name is 1-ethyl-N-methyl-N-[[2-(trifluoromethoxy)phenyl]methyl]benzotriazole-5-carboxamide.
| Compound Name | 1-ethyl-N-methyl-N-[[2-(trifluoromethoxy)phenyl]methyl]benzotriazole-5-carboxamide |
|---|---|
| PubChem CID | 38075234 |
| Molecular Formula | C18H17F3N4O2 |
| Molecular Weight | 378.35 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | 1-ethyl-N-methyl-N-[[2-(trifluoromethoxy)phenyl]methyl]benzotriazole-5-carboxamide |
| SMILES | CCn1nnc2cc(C(=O)N(C)Cc3ccccc3OC(F)(F)F)ccc21 |
| InChI | InChI=1S/C18H17F3N4O2/c1-3-25-15-9-8-12(10-14(15)22-23-25)17(26)24(2)11-13-6-4-5-7-16(13)27-18(19,20)21/h4-10H,3,11H2,1-2H3 |
| InChIKey | HWURRHLTGLWOQW-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.35 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |