C16H13F3N4O2 — CID 27298510
1-ethyl-N-[2-(trifluoromethoxy)phenyl]benzotriazole-5-carboxamide (PubChem CID 27298510) has the molecular formula C16H13F3N4O2 and a molecular weight of 350.30 g/mol. Its IUPAC name is 1-ethyl-N-[2-(trifluoromethoxy)phenyl]benzotriazole-5-carboxamide.
| Compound Name | 1-ethyl-N-[2-(trifluoromethoxy)phenyl]benzotriazole-5-carboxamide |
|---|---|
| PubChem CID | 27298510 |
| Molecular Formula | C16H13F3N4O2 |
| Molecular Weight | 350.30 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | 1-ethyl-N-[2-(trifluoromethoxy)phenyl]benzotriazole-5-carboxamide |
| SMILES | CCn1nnc2cc(C(=O)Nc3ccccc3OC(F)(F)F)ccc21 |
| InChI | InChI=1S/C16H13F3N4O2/c1-2-23-13-8-7-10(9-12(13)21-22-23)15(24)20-11-5-3-4-6-14(11)25-16(17,18)19/h3-9H,2H2,1H3,(H,20,24) |
| InChIKey | WFOHPJWZDDTMRU-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.30 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |