C17H15F3N4O2 — CID 41369673
1-ethyl-N-[2-(2,2,2-trifluoroethoxy)phenyl]benzotriazole-5-carboxamide (PubChem CID 41369673) has the molecular formula C17H15F3N4O2 and a molecular weight of 364.33 g/mol. Its IUPAC name is 1-ethyl-N-[2-(2,2,2-trifluoroethoxy)phenyl]benzotriazole-5-carboxamide.
| Compound Name | 1-ethyl-N-[2-(2,2,2-trifluoroethoxy)phenyl]benzotriazole-5-carboxamide |
|---|---|
| PubChem CID | 41369673 |
| Molecular Formula | C17H15F3N4O2 |
| Molecular Weight | 364.33 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | 1-ethyl-N-[2-(2,2,2-trifluoroethoxy)phenyl]benzotriazole-5-carboxamide |
| SMILES | CCn1nnc2cc(C(=O)Nc3ccccc3OCC(F)(F)F)ccc21 |
| InChI | InChI=1S/C17H15F3N4O2/c1-2-24-14-8-7-11(9-13(14)22-23-24)16(25)21-12-5-3-4-6-15(12)26-10-17(18,19)20/h3-9H,2,10H2,1H3,(H,21,25) |
| InChIKey | HFMXKWAOLCGVEH-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.33 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |