C23H23ClN2O4S — CID 27852892
N-[[5-(4-chlorophenyl)furan-2-yl]methyl]-N-methyl-3-pyrrolidin-1-ylsulfonylbenzamide (PubChem CID 27852892) has the molecular formula C23H23ClN2O4S and a molecular weight of 458.97 g/mol. Its IUPAC name is N-[[5-(4-chlorophenyl)furan-2-yl]methyl]-N-methyl-3-pyrrolidin-1-ylsulfonylbenzamide.
| Compound Name | N-[[5-(4-chlorophenyl)furan-2-yl]methyl]-N-methyl-3-pyrrolidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 27852892 |
| Molecular Formula | C23H23ClN2O4S |
| Molecular Weight | 458.97 g/mol |
| Exact Mass | 458.11 |
| IUPAC Name | N-[[5-(4-chlorophenyl)furan-2-yl]methyl]-N-methyl-3-pyrrolidin-1-ylsulfonylbenzamide |
| SMILES | CN(Cc1ccc(-c2ccc(Cl)cc2)o1)C(=O)c1cccc(S(=O)(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C23H23ClN2O4S/c1-25(16-20-11-12-22(30-20)17-7-9-19(24)10-8-17)23(27)18-5-4-6-21(15-18)31(28,29)26-13-2-3-14-26/h4-12,15H,2-3,13-14,16H2,1H3 |
| InChIKey | WQXDVMIUKVLPTL-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.97 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |