C19H15BrClNO3 — CID 18271169
N-[[5-(4-bromophenyl)furan-2-yl]methyl]-3-chloro-4-hydroxy-N-methylbenzamide (PubChem CID 18271169) has the molecular formula C19H15BrClNO3 and a molecular weight of 420.69 g/mol. Its IUPAC name is N-[[5-(4-bromophenyl)furan-2-yl]methyl]-3-chloro-4-hydroxy-N-methylbenzamide.
| Compound Name | N-[[5-(4-bromophenyl)furan-2-yl]methyl]-3-chloro-4-hydroxy-N-methylbenzamide |
|---|---|
| PubChem CID | 18271169 |
| Molecular Formula | C19H15BrClNO3 |
| Molecular Weight | 420.69 g/mol |
| Exact Mass | 418.99 |
| IUPAC Name | N-[[5-(4-bromophenyl)furan-2-yl]methyl]-3-chloro-4-hydroxy-N-methylbenzamide |
| SMILES | CN(Cc1ccc(-c2ccc(Br)cc2)o1)C(=O)c1ccc(O)c(Cl)c1 |
| InChI | InChI=1S/C19H15BrClNO3/c1-22(19(24)13-4-8-17(23)16(21)10-13)11-15-7-9-18(25-15)12-2-5-14(20)6-3-12/h2-10,23H,11H2,1H3 |
| InChIKey | LXUNPCLVBGGOEJ-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 53.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.69 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |