C24H29ClN4O3S — CID 159297543
prop-2-enyl 4-[5-[2-(5-chlorothiophen-2-yl)ethyl]-1-(2,2-dimethylpropanoyl)-4-isocyanopyrazol-3-yl]piperidine-1-carboxylate (PubChem CID 159297543) has the molecular formula C24H29ClN4O3S and a molecular weight of 489.04 g/mol. Its IUPAC name is prop-2-enyl 4-[5-[2-(5-chlorothiophen-2-yl)ethyl]-1-(2,2-dimethylpropanoyl)-4-isocyanopyrazol-3-yl]piperidine-1-carboxylate.
| Compound Name | prop-2-enyl 4-[5-[2-(5-chlorothiophen-2-yl)ethyl]-1-(2,2-dimethylpropanoyl)-4-isocyanopyrazol-3-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 159297543 |
| Molecular Formula | C24H29ClN4O3S |
| Molecular Weight | 489.04 g/mol |
| Exact Mass | 488.16 |
| IUPAC Name | prop-2-enyl 4-[5-[2-(5-chlorothiophen-2-yl)ethyl]-1-(2,2-dimethylpropanoyl)-4-isocyanopyrazol-3-yl]piperidine-1-carboxylate |
| SMILES | [C-]#[N+]c1c(C2CCN(C(=O)OCC=C)CC2)nn(C(=O)C(C)(C)C)c1CCc1ccc(Cl)s1 |
| InChI | InChI=1S/C24H29ClN4O3S/c1-6-15-32-23(31)28-13-11-16(12-14-28)20-21(26-5)18(9-7-17-8-10-19(25)33-17)29(27-20)22(30)24(2,3)4/h6,8,10,16H,1,7,9,11-15H2,2-4H3 |
| InChIKey | AKRPIYLGXOPOHX-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 68.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.04 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|