C42H42N4O2 — CID 159298325
3-methyl-4-(2-phenylethyl)-1-quinolin-8-ylazetidin-2-one;2-methyl-N-quinolin-8-ylbut-3-enamide;toluene (PubChem CID 159298325) has the molecular formula C42H42N4O2 and a molecular weight of 634.82 g/mol. Its IUPAC name is 3-methyl-4-(2-phenylethyl)-1-quinolin-8-ylazetidin-2-one;2-methyl-N-quinolin-8-ylbut-3-enamide;toluene.
| Compound Name | 3-methyl-4-(2-phenylethyl)-1-quinolin-8-ylazetidin-2-one;2-methyl-N-quinolin-8-ylbut-3-enamide;toluene |
|---|---|
| PubChem CID | 159298325 |
| Molecular Formula | C42H42N4O2 |
| Molecular Weight | 634.82 g/mol |
| Exact Mass | 634.33 |
| IUPAC Name | 3-methyl-4-(2-phenylethyl)-1-quinolin-8-ylazetidin-2-one;2-methyl-N-quinolin-8-ylbut-3-enamide;toluene |
| SMILES | C=CC(C)C(=O)Nc1cccc2cccnc12.CC1C(=O)N(c2cccc3cccnc23)C1CCc1ccccc1.Cc1ccccc1 |
| InChI | InChI=1S/C21H20N2O.C14H14N2O.C7H8/c1-15-18(13-12-16-7-3-2-4-8-16)23(21(15)24)19-11-5-9-17-10-6-14-22-20(17)19;1-3-10(2)14(17)16-12-8-4-6-11-7-5-9-15-13(11)12;1-7-5-3-2-4-6-7/h2-11,14-15,18H,12-13H2,1H3;3-10H,1H2,2H3,(H,16,17);2-6H,1H3 |
| InChIKey | LAZWWFJUVZSISI-UHFFFAOYSA-N |
| XLogP | 9.21 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.82 |
| LogP ≤ 5 | 9.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|