C26H30F3N3O2 — CID 159298658
5-cyclopropyl-1-[[pyridin-2-yl-[4-[2-(trifluoromethyl)phenoxy]piperidin-1-yl]methylidene]amino]pentan-2-one (PubChem CID 159298658) has the molecular formula C26H30F3N3O2 and a molecular weight of 473.54 g/mol. Its IUPAC name is 5-cyclopropyl-1-[[pyridin-2-yl-[4-[2-(trifluoromethyl)phenoxy]piperidin-1-yl]methylidene]amino]pentan-2-one.
| Compound Name | 5-cyclopropyl-1-[[pyridin-2-yl-[4-[2-(trifluoromethyl)phenoxy]piperidin-1-yl]methylidene]amino]pentan-2-one |
|---|---|
| PubChem CID | 159298658 |
| Molecular Formula | C26H30F3N3O2 |
| Molecular Weight | 473.54 g/mol |
| Exact Mass | 473.23 |
| IUPAC Name | 5-cyclopropyl-1-[[pyridin-2-yl-[4-[2-(trifluoromethyl)phenoxy]piperidin-1-yl]methylidene]amino]pentan-2-one |
| SMILES | O=C(CCCC1CC1)C/N=C(\c1ccccn1)N1CCC(Oc2ccccc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C26H30F3N3O2/c27-26(28,29)22-8-1-2-10-24(22)34-21-13-16-32(17-14-21)25(23-9-3-4-15-30-23)31-18-20(33)7-5-6-19-11-12-19/h1-4,8-10,15,19,21H,5-7,11-14,16-18H2/b31-25+ |
| InChIKey | WOZUSWFWEIFVDH-QCKNELIISA-N |
| XLogP | 5.54 |
| TPSA | 54.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.54 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|