C22H24F3N5O5 — CID 151166475
(2R)-2,5-diamino-5-oxo-2-[6-[4-[2-(trifluoromethyl)phenoxy]piperidin-1-yl]pyridazine-3-carbonyl]pentanoic acid (PubChem CID 151166475) has the molecular formula C22H24F3N5O5 and a molecular weight of 495.46 g/mol. Its IUPAC name is (2R)-2,5-diamino-5-oxo-2-[6-[4-[2-(trifluoromethyl)phenoxy]piperidin-1-yl]pyridazine-3-carbonyl]pentanoic acid.
| Compound Name | (2R)-2,5-diamino-5-oxo-2-[6-[4-[2-(trifluoromethyl)phenoxy]piperidin-1-yl]pyridazine-3-carbonyl]pentanoic acid |
|---|---|
| PubChem CID | 151166475 |
| Molecular Formula | C22H24F3N5O5 |
| Molecular Weight | 495.46 g/mol |
| Exact Mass | 495.17 |
| IUPAC Name | (2R)-2,5-diamino-5-oxo-2-[6-[4-[2-(trifluoromethyl)phenoxy]piperidin-1-yl]pyridazine-3-carbonyl]pentanoic acid |
| SMILES | NC(=O)CC[C@](N)(C(=O)O)C(=O)c1ccc(N2CCC(Oc3ccccc3C(F)(F)F)CC2)nn1 |
| InChI | InChI=1S/C22H24F3N5O5/c23-22(24,25)14-3-1-2-4-16(14)35-13-8-11-30(12-9-13)18-6-5-15(28-29-18)19(32)21(27,20(33)34)10-7-17(26)31/h1-6,13H,7-12,27H2,(H2,26,31)(H,33,34)/t21-/m1/s1 |
| InChIKey | NBIXHGVFUSCDFE-OAQYLSRUSA-N |
| XLogP | 1.77 |
| TPSA | 161.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.46 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|