C18H18F3N3O2 — CID 67172654
6-[4-[[2-(trifluoromethyl)phenyl]methyl]piperidin-1-yl]pyridazine-3-carboxylic acid (PubChem CID 67172654) has the molecular formula C18H18F3N3O2 and a molecular weight of 365.36 g/mol. Its IUPAC name is 6-[4-[[2-(trifluoromethyl)phenyl]methyl]piperidin-1-yl]pyridazine-3-carboxylic acid.
| Compound Name | 6-[4-[[2-(trifluoromethyl)phenyl]methyl]piperidin-1-yl]pyridazine-3-carboxylic acid |
|---|---|
| PubChem CID | 67172654 |
| Molecular Formula | C18H18F3N3O2 |
| Molecular Weight | 365.36 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 6-[4-[[2-(trifluoromethyl)phenyl]methyl]piperidin-1-yl]pyridazine-3-carboxylic acid |
| SMILES | O=C(O)c1ccc(N2CCC(Cc3ccccc3C(F)(F)F)CC2)nn1 |
| InChI | InChI=1S/C18H18F3N3O2/c19-18(20,21)14-4-2-1-3-13(14)11-12-7-9-24(10-8-12)16-6-5-15(17(25)26)22-23-16/h1-6,12H,7-11H2,(H,25,26) |
| InChIKey | XKSLHGBJRCABJB-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.36 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |