C22H20F3N3O2 — CID 71083472
3-[6-[4-[2-(trifluoromethyl)phenoxy]piperidin-1-yl]pyridazin-3-yl]phenol (PubChem CID 71083472) has the molecular formula C22H20F3N3O2 and a molecular weight of 415.42 g/mol. Its IUPAC name is 3-[6-[4-[2-(trifluoromethyl)phenoxy]piperidin-1-yl]pyridazin-3-yl]phenol.
| Compound Name | 3-[6-[4-[2-(trifluoromethyl)phenoxy]piperidin-1-yl]pyridazin-3-yl]phenol |
|---|---|
| PubChem CID | 71083472 |
| Molecular Formula | C22H20F3N3O2 |
| Molecular Weight | 415.42 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | 3-[6-[4-[2-(trifluoromethyl)phenoxy]piperidin-1-yl]pyridazin-3-yl]phenol |
| SMILES | Oc1cccc(-c2ccc(N3CCC(Oc4ccccc4C(F)(F)F)CC3)nn2)c1 |
| InChI | InChI=1S/C22H20F3N3O2/c23-22(24,25)18-6-1-2-7-20(18)30-17-10-12-28(13-11-17)21-9-8-19(26-27-21)15-4-3-5-16(29)14-15/h1-9,14,17,29H,10-13H2 |
| InChIKey | LKCYNMTYAKNJCN-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 58.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.42 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |