C17H16FNO3S — CID 159304761
methyl (E)-6-[2-(2-fluorophenyl)-4-methyl-1,3-thiazol-5-yl]-6-oxohex-2-enoate (PubChem CID 159304761) has the molecular formula C17H16FNO3S and a molecular weight of 333.38 g/mol. Its IUPAC name is methyl (E)-6-[2-(2-fluorophenyl)-4-methyl-1,3-thiazol-5-yl]-6-oxohex-2-enoate.
| Compound Name | methyl (E)-6-[2-(2-fluorophenyl)-4-methyl-1,3-thiazol-5-yl]-6-oxohex-2-enoate |
|---|---|
| PubChem CID | 159304761 |
| Molecular Formula | C17H16FNO3S |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | methyl (E)-6-[2-(2-fluorophenyl)-4-methyl-1,3-thiazol-5-yl]-6-oxohex-2-enoate |
| SMILES | COC(=O)/C=C/CCC(=O)c1sc(-c2ccccc2F)nc1C |
| InChI | InChI=1S/C17H16FNO3S/c1-11-16(14(20)9-5-6-10-15(21)22-2)23-17(19-11)12-7-3-4-8-13(12)18/h3-4,6-8,10H,5,9H2,1-2H3/b10-6+ |
| InChIKey | WQRBOZIBFDXLLM-UXBLZVDNSA-N |
| XLogP | 3.95 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|