C15H10FN3OS2 — CID 75407069
(E)-1-[2-(2-fluorophenyl)-4-methyl-1,3-thiazol-5-yl]-3-(thiadiazol-4-yl)prop-2-en-1-one (PubChem CID 75407069) has the molecular formula C15H10FN3OS2 and a molecular weight of 331.40 g/mol. Its IUPAC name is (E)-1-[2-(2-fluorophenyl)-4-methyl-1,3-thiazol-5-yl]-3-(thiadiazol-4-yl)prop-2-en-1-one.
| Compound Name | (E)-1-[2-(2-fluorophenyl)-4-methyl-1,3-thiazol-5-yl]-3-(thiadiazol-4-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 75407069 |
| Molecular Formula | C15H10FN3OS2 |
| Molecular Weight | 331.40 g/mol |
| Exact Mass | 331.02 |
| IUPAC Name | (E)-1-[2-(2-fluorophenyl)-4-methyl-1,3-thiazol-5-yl]-3-(thiadiazol-4-yl)prop-2-en-1-one |
| SMILES | Cc1nc(-c2ccccc2F)sc1C(=O)/C=C/c1csnn1 |
| InChI | InChI=1S/C15H10FN3OS2/c1-9-14(13(20)7-6-10-8-21-19-18-10)22-15(17-9)11-4-2-3-5-12(11)16/h2-8H,1H3/b7-6+ |
| InChIKey | KVXLZXBLNSASHB-VOTSOKGWSA-N |
| XLogP | 4.01 |
| TPSA | 55.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.40 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|