C33H23Br5O4 — CID 159305203
1,3-bis(3-bromophenoxy)-1,3-bis(4-bromophenyl)propan-2-one;3-bromophenol (PubChem CID 159305203) has the molecular formula C33H23Br5O4 and a molecular weight of 883.06 g/mol. Its IUPAC name is 1,3-bis(3-bromophenoxy)-1,3-bis(4-bromophenyl)propan-2-one;3-bromophenol.
| Compound Name | 1,3-bis(3-bromophenoxy)-1,3-bis(4-bromophenyl)propan-2-one;3-bromophenol |
|---|---|
| PubChem CID | 159305203 |
| Molecular Formula | C33H23Br5O4 |
| Molecular Weight | 883.06 g/mol |
| Exact Mass | 877.75 |
| IUPAC Name | 1,3-bis(3-bromophenoxy)-1,3-bis(4-bromophenyl)propan-2-one;3-bromophenol |
| SMILES | O=C(C(Oc1cccc(Br)c1)c1ccc(Br)cc1)C(Oc1cccc(Br)c1)c1ccc(Br)cc1.Oc1cccc(Br)c1 |
| InChI | InChI=1S/C27H18Br4O3.C6H5BrO/c28-19-11-7-17(8-12-19)26(33-23-5-1-3-21(30)15-23)25(32)27(18-9-13-20(29)14-10-18)34-24-6-2-4-22(31)16-24;7-5-2-1-3-6(8)4-5/h1-16,26-27H;1-4,8H |
| InChIKey | LBVIEKARDDSHOS-UHFFFAOYSA-N |
| XLogP | 11.40 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 883.06 |
| LogP ≤ 5 | 11.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |