About chloro-(4-chlorophenyl)-tetrafluoro-λ6-sulfane;1-chloro-4-(phenyldisulfanyl)benzene
chloro-(4-chlorophenyl)-tetrafluoro-λ6-sulfane;1-chloro-4-(phenyldisulfanyl)benzene (PubChem CID 159307363) has the molecular formula C18H13Cl3F4S3
and a molecular weight of 507.85 g/mol. Its IUPAC name is chloro-(4-chlorophenyl)-tetrafluoro-λ6-sulfane;1-chloro-4-(phenyldisulfanyl)benzene.
Molecular Properties
| Compound Name | chloro-(4-chlorophenyl)-tetrafluoro-λ6-sulfane;1-chloro-4-(phenyldisulfanyl)benzene |
| PubChem CID | 159307363 |
| Molecular Formula | C18H13Cl3F4S3 |
| Molecular Weight | 507.85 g/mol |
| Exact Mass | 505.92 |
| IUPAC Name | chloro-(4-chlorophenyl)-tetrafluoro-λ6-sulfane;1-chloro-4-(phenyldisulfanyl)benzene |
| SMILES | Clc1ccc(SSc2ccccc2)cc1.FS(F)(F)(F)(Cl)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H9ClS2.C6H4Cl2F4S/c13-10-6-8-12(9-7-10)15-14-11-4-2-1-3-5-11;7-5-1-3-6(4-2-5)13(8,9,10,11)12/h1-9H;1-4H |
| InChIKey | LCBXCCKFEROMTO-UHFFFAOYSA-N |
| XLogP | 10.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 507.85 |
| LogP ≤ 5 | 10.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|
Analyze chloro-(4-chlorophenyl)-tetrafluoro-λ6-sulfane;1-chloro-4-(phenyldisulfanyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloro-(4-chlorophenyl)-tetrafluoro-λ6-sulfane;1-chloro-4-(phenyldisulfanyl)benzene?
The IUPAC name of chloro-(4-chlorophenyl)-tetrafluoro-λ6-sulfane;1-chloro-4-(phenyldisulfanyl)benzene (CID 159307363) is chloro-(4-chlorophenyl)-tetrafluoro-λ6-sulfane;1-chloro-4-(phenyldisulfanyl)benzene.
What is the SMILES notation for chloro-(4-chlorophenyl)-tetrafluoro-λ6-sulfane;1-chloro-4-(phenyldisulfanyl)benzene?
The canonical SMILES for chloro-(4-chlorophenyl)-tetrafluoro-λ6-sulfane;1-chloro-4-(phenyldisulfanyl)benzene is Clc1ccc(SSc2ccccc2)cc1.FS(F)(F)(F)(Cl)c1ccc(Cl)cc1.
What is the InChIKey of chloro-(4-chlorophenyl)-tetrafluoro-λ6-sulfane;1-chloro-4-(phenyldisulfanyl)benzene?
The InChIKey is LCBXCCKFEROMTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9ClS2.C6H4Cl2F4S/c13-10-6-8-12(9-7-10)15-14-11-4-2-1-3-5-11;7-5-1-3-6(4-2-5)13(8,9,10,11)12/h1-9H;1-4H.
What are the key properties of chloro-(4-chlorophenyl)-tetrafluoro-λ6-sulfane;1-chloro-4-(phenyldisulfanyl)benzene?
chloro-(4-chlorophenyl)-tetrafluoro-λ6-sulfane;1-chloro-4-(phenyldisulfanyl)benzene has a molecular weight of 507.85 g/mol, XLogP of 10.41, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for chloro-(4-chlorophenyl)-tetrafluoro-λ6-sulfane;1-chloro-4-(phenyldisulfanyl)benzene is sourced from PubChem (CID 159307363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).