About chloro-[3-chloro-5-[chloro(tetrafluoro)-λ6-sulfanyl]phenyl]-tetrafluoro-λ6-sulfane
chloro-[3-chloro-5-[chloro(tetrafluoro)-λ6-sulfanyl]phenyl]-tetrafluoro-λ6-sulfane (PubChem CID 142709131) has the molecular formula C6H3Cl3F8S2
and a molecular weight of 397.57 g/mol. Its IUPAC name is chloro-[3-chloro-5-[chloro(tetrafluoro)-λ6-sulfanyl]phenyl]-tetrafluoro-λ6-sulfane.
Molecular Properties
| Compound Name | chloro-[3-chloro-5-[chloro(tetrafluoro)-λ6-sulfanyl]phenyl]-tetrafluoro-λ6-sulfane |
| PubChem CID | 142709131 |
| Molecular Formula | C6H3Cl3F8S2 |
| Molecular Weight | 397.57 g/mol |
| Exact Mass | 395.86 |
| IUPAC Name | chloro-[3-chloro-5-[chloro(tetrafluoro)-λ6-sulfanyl]phenyl]-tetrafluoro-λ6-sulfane |
| SMILES | FS(F)(F)(F)(Cl)c1cc(Cl)cc(S(F)(F)(F)(F)Cl)c1 |
| InChI | InChI=1S/C6H3Cl3F8S2/c7-4-1-5(18(8,10,11,12)13)3-6(2-4)19(9,14,15,16)17/h1-3H |
| InChIKey | DPRKIHALJWFRJZ-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 397.57 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze chloro-[3-chloro-5-[chloro(tetrafluoro)-λ6-sulfanyl]phenyl]-tetrafluoro-λ6-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloro-[3-chloro-5-[chloro(tetrafluoro)-λ6-sulfanyl]phenyl]-tetrafluoro-λ6-sulfane?
The IUPAC name of chloro-[3-chloro-5-[chloro(tetrafluoro)-λ6-sulfanyl]phenyl]-tetrafluoro-λ6-sulfane (CID 142709131) is chloro-[3-chloro-5-[chloro(tetrafluoro)-λ6-sulfanyl]phenyl]-tetrafluoro-λ6-sulfane.
What is the SMILES notation for chloro-[3-chloro-5-[chloro(tetrafluoro)-λ6-sulfanyl]phenyl]-tetrafluoro-λ6-sulfane?
The canonical SMILES for chloro-[3-chloro-5-[chloro(tetrafluoro)-λ6-sulfanyl]phenyl]-tetrafluoro-λ6-sulfane is FS(F)(F)(F)(Cl)c1cc(Cl)cc(S(F)(F)(F)(F)Cl)c1.
What is the InChIKey of chloro-[3-chloro-5-[chloro(tetrafluoro)-λ6-sulfanyl]phenyl]-tetrafluoro-λ6-sulfane?
The InChIKey is DPRKIHALJWFRJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3Cl3F8S2/c7-4-1-5(18(8,10,11,12)13)3-6(2-4)19(9,14,15,16)17/h1-3H.
What are the key properties of chloro-[3-chloro-5-[chloro(tetrafluoro)-λ6-sulfanyl]phenyl]-tetrafluoro-λ6-sulfane?
chloro-[3-chloro-5-[chloro(tetrafluoro)-λ6-sulfanyl]phenyl]-tetrafluoro-λ6-sulfane has a molecular weight of 397.57 g/mol, XLogP of 8.19, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for chloro-[3-chloro-5-[chloro(tetrafluoro)-λ6-sulfanyl]phenyl]-tetrafluoro-λ6-sulfane is sourced from PubChem (CID 142709131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).