C30H32N6O — CID 159308424
(2R)-2-methyl-4-[6-methyl-5-[[3-[2-[[(3S)-piperidin-3-yl]amino]pyrimidin-4-yl]-2-pyridinyl]oxy]naphthalen-1-yl]butanenitrile (PubChem CID 159308424) has the molecular formula C30H32N6O and a molecular weight of 492.63 g/mol. Its IUPAC name is (2R)-2-methyl-4-[6-methyl-5-[[3-[2-[[(3S)-piperidin-3-yl]amino]pyrimidin-4-yl]-2-pyridinyl]oxy]naphthalen-1-yl]butanenitrile.
| Compound Name | (2R)-2-methyl-4-[6-methyl-5-[[3-[2-[[(3S)-piperidin-3-yl]amino]pyrimidin-4-yl]-2-pyridinyl]oxy]naphthalen-1-yl]butanenitrile |
|---|---|
| PubChem CID | 159308424 |
| Molecular Formula | C30H32N6O |
| Molecular Weight | 492.63 g/mol |
| Exact Mass | 492.26 |
| IUPAC Name | (2R)-2-methyl-4-[6-methyl-5-[[3-[2-[[(3S)-piperidin-3-yl]amino]pyrimidin-4-yl]-2-pyridinyl]oxy]naphthalen-1-yl]butanenitrile |
| SMILES | Cc1ccc2c(CC[C@@H](C)C#N)cccc2c1Oc1ncccc1-c1ccnc(N[C@H]2CCCNC2)n1 |
| InChI | InChI=1S/C30H32N6O/c1-20(18-31)10-12-22-6-3-8-25-24(22)13-11-21(2)28(25)37-29-26(9-5-16-33-29)27-14-17-34-30(36-27)35-23-7-4-15-32-19-23/h3,5-6,8-9,11,13-14,16-17,20,23,32H,4,7,10,12,15,19H2,1-2H3,(H,34,35,36)/t20-,23+/m1/s1 |
| InChIKey | LCFJAEQMWYYGIQ-OFNKIYASSA-N |
| XLogP | 6.05 |
| TPSA | 95.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.63 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |