C30H34FN5O — CID 159547365
4-[2-[5-(4-fluoro-3-methylbutyl)-2-methylnaphthalen-1-yl]oxy-3-pyridinyl]-N-[(3S)-piperidin-3-yl]pyrimidin-2-amine (PubChem CID 159547365) has the molecular formula C30H34FN5O and a molecular weight of 499.63 g/mol. Its IUPAC name is 4-[2-[5-(4-fluoro-3-methylbutyl)-2-methylnaphthalen-1-yl]oxy-3-pyridinyl]-N-[(3S)-piperidin-3-yl]pyrimidin-2-amine.
| Compound Name | 4-[2-[5-(4-fluoro-3-methylbutyl)-2-methylnaphthalen-1-yl]oxy-3-pyridinyl]-N-[(3S)-piperidin-3-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 159547365 |
| Molecular Formula | C30H34FN5O |
| Molecular Weight | 499.63 g/mol |
| Exact Mass | 499.27 |
| IUPAC Name | 4-[2-[5-(4-fluoro-3-methylbutyl)-2-methylnaphthalen-1-yl]oxy-3-pyridinyl]-N-[(3S)-piperidin-3-yl]pyrimidin-2-amine |
| SMILES | Cc1ccc2c(CCC(C)CF)cccc2c1Oc1ncccc1-c1ccnc(N[C@H]2CCCNC2)n1 |
| InChI | InChI=1S/C30H34FN5O/c1-20(18-31)10-12-22-6-3-8-25-24(22)13-11-21(2)28(25)37-29-26(9-5-16-33-29)27-14-17-34-30(36-27)35-23-7-4-15-32-19-23/h3,5-6,8-9,11,13-14,16-17,20,23,32H,4,7,10,12,15,18-19H2,1-2H3,(H,34,35,36)/t20?,23-/m0/s1 |
| InChIKey | QFHYIELTDTZVRS-AKRCKQFNSA-N |
| XLogP | 6.49 |
| TPSA | 71.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.63 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |