C29H54F6N6O4 — CID 159310433
tert-butyl N-piperidin-4-ylcarbamate;tert-butyl N-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]carbamate;1-(2,2,2-trifluoroethyl)piperidin-4-amine (PubChem CID 159310433) has the molecular formula C29H54F6N6O4 and a molecular weight of 664.78 g/mol. Its IUPAC name is tert-butyl N-piperidin-4-ylcarbamate;tert-butyl N-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]carbamate;1-(2,2,2-trifluoroethyl)piperidin-4-amine.
| Compound Name | tert-butyl N-piperidin-4-ylcarbamate;tert-butyl N-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]carbamate;1-(2,2,2-trifluoroethyl)piperidin-4-amine |
|---|---|
| PubChem CID | 159310433 |
| Molecular Formula | C29H54F6N6O4 |
| Molecular Weight | 664.78 g/mol |
| Exact Mass | 664.41 |
| IUPAC Name | tert-butyl N-piperidin-4-ylcarbamate;tert-butyl N-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]carbamate;1-(2,2,2-trifluoroethyl)piperidin-4-amine |
| SMILES | CC(C)(C)OC(=O)NC1CCN(CC(F)(F)F)CC1.CC(C)(C)OC(=O)NC1CCNCC1.NC1CCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C12H21F3N2O2.C10H20N2O2.C7H13F3N2/c1-11(2,3)19-10(18)16-9-4-6-17(7-5-9)8-12(13,14)15;1-10(2,3)14-9(13)12-8-4-6-11-7-5-8;8-7(9,10)5-12-3-1-6(11)2-4-12/h9H,4-8H2,1-3H3,(H,16,18);8,11H,4-7H2,1-3H3,(H,12,13);6H,1-5,11H2 |
| InChIKey | LCLSZIPVSNOLSO-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 121.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.78 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |