C25H21ClN4O2 — CID 159311926
N-(2-chlorophenyl)-2-[1-[3-[2-(2-methyl-4-pyridinyl)acetyl]phenyl]pyrazol-4-yl]acetamide (PubChem CID 159311926) has the molecular formula C25H21ClN4O2 and a molecular weight of 444.92 g/mol. Its IUPAC name is N-(2-chlorophenyl)-2-[1-[3-[2-(2-methyl-4-pyridinyl)acetyl]phenyl]pyrazol-4-yl]acetamide.
| Compound Name | N-(2-chlorophenyl)-2-[1-[3-[2-(2-methyl-4-pyridinyl)acetyl]phenyl]pyrazol-4-yl]acetamide |
|---|---|
| PubChem CID | 159311926 |
| Molecular Formula | C25H21ClN4O2 |
| Molecular Weight | 444.92 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | N-(2-chlorophenyl)-2-[1-[3-[2-(2-methyl-4-pyridinyl)acetyl]phenyl]pyrazol-4-yl]acetamide |
| SMILES | Cc1cc(CC(=O)c2cccc(-n3cc(CC(=O)Nc4ccccc4Cl)cn3)c2)ccn1 |
| InChI | InChI=1S/C25H21ClN4O2/c1-17-11-18(9-10-27-17)12-24(31)20-5-4-6-21(14-20)30-16-19(15-28-30)13-25(32)29-23-8-3-2-7-22(23)26/h2-11,14-16H,12-13H2,1H3,(H,29,32) |
| InChIKey | PEUIDJAMPYWEDQ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.92 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |