C26H22BClN4O2 — CID 159312064
2-chloro-5-(isocyanomethyl)pyridine;5-(isocyanomethyl)-2-phenylpyridine;phenylboronic acid (PubChem CID 159312064) has the molecular formula C26H22BClN4O2 and a molecular weight of 468.75 g/mol. Its IUPAC name is 2-chloro-5-(isocyanomethyl)pyridine;5-(isocyanomethyl)-2-phenylpyridine;phenylboronic acid.
| Compound Name | 2-chloro-5-(isocyanomethyl)pyridine;5-(isocyanomethyl)-2-phenylpyridine;phenylboronic acid |
|---|---|
| PubChem CID | 159312064 |
| Molecular Formula | C26H22BClN4O2 |
| Molecular Weight | 468.75 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | 2-chloro-5-(isocyanomethyl)pyridine;5-(isocyanomethyl)-2-phenylpyridine;phenylboronic acid |
| SMILES | OB(O)c1ccccc1.[C-]#[N+]Cc1ccc(-c2ccccc2)nc1.[C-]#[N+]Cc1ccc(Cl)nc1 |
| InChI | InChI=1S/C13H10N2.C7H5ClN2.C6H7BO2/c1-14-9-11-7-8-13(15-10-11)12-5-3-2-4-6-12;1-9-4-6-2-3-7(8)10-5-6;8-7(9)6-4-2-1-3-5-6/h2-8,10H,9H2;2-3,5H,4H2;1-5,8-9H |
| InChIKey | LCRCVMVNNXDARV-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 74.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.75 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|