C51H75BrN6O2 — CID 159314189
2-bromo-6-(3,5-ditert-butylphenyl)pyridine;tert-butyl piperazine-1-carboxylate;1-[6-(3,5-ditert-butylphenyl)-2-pyridinyl]piperazine (PubChem CID 159314189) has the molecular formula C51H75BrN6O2 and a molecular weight of 884.10 g/mol. Its IUPAC name is 2-bromo-6-(3,5-ditert-butylphenyl)pyridine;tert-butyl piperazine-1-carboxylate;1-[6-(3,5-ditert-butylphenyl)-2-pyridinyl]piperazine.
| Compound Name | 2-bromo-6-(3,5-ditert-butylphenyl)pyridine;tert-butyl piperazine-1-carboxylate;1-[6-(3,5-ditert-butylphenyl)-2-pyridinyl]piperazine |
|---|---|
| PubChem CID | 159314189 |
| Molecular Formula | C51H75BrN6O2 |
| Molecular Weight | 884.10 g/mol |
| Exact Mass | 882.51 |
| IUPAC Name | 2-bromo-6-(3,5-ditert-butylphenyl)pyridine;tert-butyl piperazine-1-carboxylate;1-[6-(3,5-ditert-butylphenyl)-2-pyridinyl]piperazine |
| SMILES | CC(C)(C)OC(=O)N1CCNCC1.CC(C)(C)c1cc(-c2cccc(Br)n2)cc(C(C)(C)C)c1.CC(C)(C)c1cc(-c2cccc(N3CCNCC3)n2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C23H33N3.C19H24BrN.C9H18N2O2/c1-22(2,3)18-14-17(15-19(16-18)23(4,5)6)20-8-7-9-21(25-20)26-12-10-24-11-13-26;1-18(2,3)14-10-13(11-15(12-14)19(4,5)6)16-8-7-9-17(20)21-16;1-9(2,3)13-8(12)11-6-4-10-5-7-11/h7-9,14-16,24H,10-13H2,1-6H3;7-12H,1-6H3;10H,4-7H2,1-3H3 |
| InChIKey | LCXVLJKTHUHCNO-UHFFFAOYSA-N |
| XLogP | 11.69 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 884.10 |
| LogP ≤ 5 | 11.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|