About 5-bromo-1H-indazole;tert-butyl 5-bromoindazole-1-carboxylate
5-bromo-1H-indazole;tert-butyl 5-bromoindazole-1-carboxylate (PubChem CID 159314489) has the molecular formula C19H18Br2N4O2
and a molecular weight of 494.19 g/mol. Its IUPAC name is 5-bromo-1H-indazole;tert-butyl 5-bromoindazole-1-carboxylate.
Molecular Properties
| Compound Name | 5-bromo-1H-indazole;tert-butyl 5-bromoindazole-1-carboxylate |
| PubChem CID | 159314489 |
| Molecular Formula | C19H18Br2N4O2 |
| Molecular Weight | 494.19 g/mol |
| Exact Mass | 491.98 |
| IUPAC Name | 5-bromo-1H-indazole;tert-butyl 5-bromoindazole-1-carboxylate |
| SMILES | Brc1ccc2[nH]ncc2c1.CC(C)(C)OC(=O)n1ncc2cc(Br)ccc21 |
| InChI | InChI=1S/C12H13BrN2O2.C7H5BrN2/c1-12(2,3)17-11(16)15-10-5-4-9(13)6-8(10)7-14-15;8-6-1-2-7-5(3-6)4-9-10-7/h4-7H,1-3H3;1-4H,(H,9,10) |
| InChIKey | LCYRWBJABPGMJQ-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 494.19 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-bromo-1H-indazole;tert-butyl 5-bromoindazole-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-1H-indazole;tert-butyl 5-bromoindazole-1-carboxylate?
The IUPAC name of 5-bromo-1H-indazole;tert-butyl 5-bromoindazole-1-carboxylate (CID 159314489) is 5-bromo-1H-indazole;tert-butyl 5-bromoindazole-1-carboxylate.
What is the SMILES notation for 5-bromo-1H-indazole;tert-butyl 5-bromoindazole-1-carboxylate?
The canonical SMILES for 5-bromo-1H-indazole;tert-butyl 5-bromoindazole-1-carboxylate is Brc1ccc2[nH]ncc2c1.CC(C)(C)OC(=O)n1ncc2cc(Br)ccc21.
What is the InChIKey of 5-bromo-1H-indazole;tert-butyl 5-bromoindazole-1-carboxylate?
The InChIKey is LCYRWBJABPGMJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13BrN2O2.C7H5BrN2/c1-12(2,3)17-11(16)15-10-5-4-9(13)6-8(10)7-14-15;8-6-1-2-7-5(3-6)4-9-10-7/h4-7H,1-3H3;1-4H,(H,9,10).
What are the key properties of 5-bromo-1H-indazole;tert-butyl 5-bromoindazole-1-carboxylate?
5-bromo-1H-indazole;tert-butyl 5-bromoindazole-1-carboxylate has a molecular weight of 494.19 g/mol, XLogP of 5.91, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-1H-indazole;tert-butyl 5-bromoindazole-1-carboxylate is sourced from PubChem (CID 159314489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).