C14H11ClF2N4O — CID 159315914
2-(chloromethyl)-7-fluoropyrido[1,2-a]pyrimidin-4-one;5-fluoropyridin-2-amine (PubChem CID 159315914) has the molecular formula C14H11ClF2N4O and a molecular weight of 324.72 g/mol. Its IUPAC name is 2-(chloromethyl)-7-fluoropyrido[1,2-a]pyrimidin-4-one;5-fluoropyridin-2-amine.
| Compound Name | 2-(chloromethyl)-7-fluoropyrido[1,2-a]pyrimidin-4-one;5-fluoropyridin-2-amine |
|---|---|
| PubChem CID | 159315914 |
| Molecular Formula | C14H11ClF2N4O |
| Molecular Weight | 324.72 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | 2-(chloromethyl)-7-fluoropyrido[1,2-a]pyrimidin-4-one;5-fluoropyridin-2-amine |
| SMILES | Nc1ccc(F)cn1.O=c1cc(CCl)nc2ccc(F)cn12 |
| InChI | InChI=1S/C9H6ClFN2O.C5H5FN2/c10-4-7-3-9(14)13-5-6(11)1-2-8(13)12-7;6-4-1-2-5(7)8-3-4/h1-3,5H,4H2;1-3H,(H2,7,8) |
| InChIKey | LDDAEFWUSSQUOD-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 73.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.72 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|