C19H22N2O3 — CID 159322138
(3R)-3-[(1S)-1-methoxyethyl]-3-(phenylmethoxyamino)-1,4-dihydroquinolin-2-one (PubChem CID 159322138) has the molecular formula C19H22N2O3 and a molecular weight of 326.40 g/mol. Its IUPAC name is (3R)-3-[(1S)-1-methoxyethyl]-3-(phenylmethoxyamino)-1,4-dihydroquinolin-2-one.
| Compound Name | (3R)-3-[(1S)-1-methoxyethyl]-3-(phenylmethoxyamino)-1,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 159322138 |
| Molecular Formula | C19H22N2O3 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | (3R)-3-[(1S)-1-methoxyethyl]-3-(phenylmethoxyamino)-1,4-dihydroquinolin-2-one |
| SMILES | CO[C@@H](C)[C@]1(NOCc2ccccc2)Cc2ccccc2NC1=O |
| InChI | InChI=1S/C19H22N2O3/c1-14(23-2)19(21-24-13-15-8-4-3-5-9-15)12-16-10-6-7-11-17(16)20-18(19)22/h3-11,14,21H,12-13H2,1-2H3,(H,20,22)/t14-,19+/m0/s1 |
| InChIKey | LDXACBFRTDYGQZ-IFXJQAMLSA-N |
| XLogP | 2.68 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|