C26H25NO8 — CID 15932246
(7-acetyloxy-2,3,9,10-tetramethoxy-5-methylbenzo[b]phenanthridin-12-yl) acetate (PubChem CID 15932246) has the molecular formula C26H25NO8 and a molecular weight of 479.49 g/mol. Its IUPAC name is (7-acetyloxy-2,3,9,10-tetramethoxy-5-methylbenzo[b]phenanthridin-12-yl) acetate.
| Compound Name | (7-acetyloxy-2,3,9,10-tetramethoxy-5-methylbenzo[b]phenanthridin-12-yl) acetate |
|---|---|
| PubChem CID | 15932246 |
| Molecular Formula | C26H25NO8 |
| Molecular Weight | 479.49 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | (7-acetyloxy-2,3,9,10-tetramethoxy-5-methylbenzo[b]phenanthridin-12-yl) acetate |
| SMILES | COc1cc2c(OC(C)=O)c3nc(C)c4cc(OC)c(OC)cc4c3c(OC(C)=O)c2cc1OC |
| InChI | InChI=1S/C26H25NO8/c1-12-15-8-19(30-4)20(31-5)9-16(15)23-24(27-12)26(35-14(3)29)18-11-22(33-7)21(32-6)10-17(18)25(23)34-13(2)28/h8-11H,1-7H3 |
| InChIKey | HWTLGSLMDZKVSZ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 102.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.49 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|