About 4-amino-2-(hydroperoxymethyl)phenol;vanadium
4-amino-2-(hydroperoxymethyl)phenol;vanadium (PubChem CID 159326049) has the molecular formula C7H9NO3V
and a molecular weight of 206.10 g/mol. Its IUPAC name is 4-amino-2-(hydroperoxymethyl)phenol;vanadium.
Molecular Properties
| Compound Name | 4-amino-2-(hydroperoxymethyl)phenol;vanadium |
| PubChem CID | 159326049 |
| Molecular Formula | C7H9NO3V |
| Molecular Weight | 206.10 g/mol |
| Exact Mass | 206.00 |
| IUPAC Name | 4-amino-2-(hydroperoxymethyl)phenol;vanadium |
| SMILES | Nc1ccc(O)c(COO)c1.[V] |
| InChI | InChI=1S/C7H9NO3.V/c8-6-1-2-7(9)5(3-6)4-11-10;/h1-3,9-10H,4,8H2; |
| InChIKey | LEJMCGPMKYLSMQ-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.10 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-2-(hydroperoxymethyl)phenol;vanadium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-2-(hydroperoxymethyl)phenol;vanadium?
The IUPAC name of 4-amino-2-(hydroperoxymethyl)phenol;vanadium (CID 159326049) is 4-amino-2-(hydroperoxymethyl)phenol;vanadium.
What is the SMILES notation for 4-amino-2-(hydroperoxymethyl)phenol;vanadium?
The canonical SMILES for 4-amino-2-(hydroperoxymethyl)phenol;vanadium is Nc1ccc(O)c(COO)c1.[V].
What is the InChIKey of 4-amino-2-(hydroperoxymethyl)phenol;vanadium?
The InChIKey is LEJMCGPMKYLSMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO3.V/c8-6-1-2-7(9)5(3-6)4-11-10;/h1-3,9-10H,4,8H2;.
What are the key properties of 4-amino-2-(hydroperoxymethyl)phenol;vanadium?
4-amino-2-(hydroperoxymethyl)phenol;vanadium has a molecular weight of 206.10 g/mol, XLogP of 0.96, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-2-(hydroperoxymethyl)phenol;vanadium is sourced from PubChem (CID 159326049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).