C16H23FN2OS — CID 159326418
(5R)-5-[2-fluoro-5-(4-methylsulfanylbutyl)phenyl]-5-methyl-2,6-dihydro-1,4-oxazin-3-amine (PubChem CID 159326418) has the molecular formula C16H23FN2OS and a molecular weight of 310.44 g/mol. Its IUPAC name is (5R)-5-[2-fluoro-5-(4-methylsulfanylbutyl)phenyl]-5-methyl-2,6-dihydro-1,4-oxazin-3-amine.
| Compound Name | (5R)-5-[2-fluoro-5-(4-methylsulfanylbutyl)phenyl]-5-methyl-2,6-dihydro-1,4-oxazin-3-amine |
|---|---|
| PubChem CID | 159326418 |
| Molecular Formula | C16H23FN2OS |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | (5R)-5-[2-fluoro-5-(4-methylsulfanylbutyl)phenyl]-5-methyl-2,6-dihydro-1,4-oxazin-3-amine |
| SMILES | CSCCCCc1ccc(F)c([C@]2(C)COCC(N)=N2)c1 |
| InChI | InChI=1S/C16H23FN2OS/c1-16(11-20-10-15(18)19-16)13-9-12(6-7-14(13)17)5-3-4-8-21-2/h6-7,9H,3-5,8,10-11H2,1-2H3,(H2,18,19)/t16-/m0/s1 |
| InChIKey | LEKPDNAYLASJSX-INIZCTEOSA-N |
| XLogP | 3.11 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|