C22H26N4O3S — CID 159327659
6-methoxy-1-(4-morpholin-4-yl-2-pyridin-2-ylthieno[2,3-d]pyrimidin-5-yl)hexan-1-one (PubChem CID 159327659) has the molecular formula C22H26N4O3S and a molecular weight of 426.54 g/mol. Its IUPAC name is 6-methoxy-1-(4-morpholin-4-yl-2-pyridin-2-ylthieno[2,3-d]pyrimidin-5-yl)hexan-1-one.
| Compound Name | 6-methoxy-1-(4-morpholin-4-yl-2-pyridin-2-ylthieno[2,3-d]pyrimidin-5-yl)hexan-1-one |
|---|---|
| PubChem CID | 159327659 |
| Molecular Formula | C22H26N4O3S |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | 6-methoxy-1-(4-morpholin-4-yl-2-pyridin-2-ylthieno[2,3-d]pyrimidin-5-yl)hexan-1-one |
| SMILES | COCCCCCC(=O)c1csc2nc(-c3ccccn3)nc(N3CCOCC3)c12 |
| InChI | InChI=1S/C22H26N4O3S/c1-28-12-6-2-3-8-18(27)16-15-30-22-19(16)21(26-10-13-29-14-11-26)24-20(25-22)17-7-4-5-9-23-17/h4-5,7,9,15H,2-3,6,8,10-14H2,1H3 |
| InChIKey | WUWYVQGMIYVKMH-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 77.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|