C21H25N5O4S2 — CID 142506400
4-(1,1-dioxo-1,4-thiazinan-4-yl)-N-(4-methoxybutyl)-2-pyridin-2-ylthieno[2,3-d]pyrimidine-5-carboxamide (PubChem CID 142506400) has the molecular formula C21H25N5O4S2 and a molecular weight of 475.60 g/mol. Its IUPAC name is 4-(1,1-dioxo-1,4-thiazinan-4-yl)-N-(4-methoxybutyl)-2-pyridin-2-ylthieno[2,3-d]pyrimidine-5-carboxamide.
| Compound Name | 4-(1,1-dioxo-1,4-thiazinan-4-yl)-N-(4-methoxybutyl)-2-pyridin-2-ylthieno[2,3-d]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 142506400 |
| Molecular Formula | C21H25N5O4S2 |
| Molecular Weight | 475.60 g/mol |
| Exact Mass | 475.13 |
| IUPAC Name | 4-(1,1-dioxo-1,4-thiazinan-4-yl)-N-(4-methoxybutyl)-2-pyridin-2-ylthieno[2,3-d]pyrimidine-5-carboxamide |
| SMILES | COCCCCNC(=O)c1csc2nc(-c3ccccn3)nc(N3CCS(=O)(=O)CC3)c12 |
| InChI | InChI=1S/C21H25N5O4S2/c1-30-11-5-4-8-23-20(27)15-14-31-21-17(15)19(26-9-12-32(28,29)13-10-26)24-18(25-21)16-6-2-3-7-22-16/h2-3,6-7,14H,4-5,8-13H2,1H3,(H,23,27) |
| InChIKey | PKYCSEGKDAROIL-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 114.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.60 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|