C17H22F2N6O — CID 159330970
(E)-3-[1-(difluoromethyl)pyrazol-4-yl]-1-[(3R)-3-[(4-ethyltriazol-1-yl)methyl]piperidin-1-yl]prop-2-en-1-one (PubChem CID 159330970) has the molecular formula C17H22F2N6O and a molecular weight of 364.40 g/mol. Its IUPAC name is (E)-3-[1-(difluoromethyl)pyrazol-4-yl]-1-[(3R)-3-[(4-ethyltriazol-1-yl)methyl]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-[1-(difluoromethyl)pyrazol-4-yl]-1-[(3R)-3-[(4-ethyltriazol-1-yl)methyl]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 159330970 |
| Molecular Formula | C17H22F2N6O |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | (E)-3-[1-(difluoromethyl)pyrazol-4-yl]-1-[(3R)-3-[(4-ethyltriazol-1-yl)methyl]piperidin-1-yl]prop-2-en-1-one |
| SMILES | CCc1cn(C[C@@H]2CCCN(C(=O)/C=C/c3cnn(C(F)F)c3)C2)nn1 |
| InChI | InChI=1S/C17H22F2N6O/c1-2-15-12-24(22-21-15)10-14-4-3-7-23(9-14)16(26)6-5-13-8-20-25(11-13)17(18)19/h5-6,8,11-12,14,17H,2-4,7,9-10H2,1H3/b6-5+/t14-/m1/s1 |
| InChIKey | OCYGZIAHCZKBJI-VBROQKIQSA-N |
| XLogP | 2.38 |
| TPSA | 68.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|