C16H28N6OS — CID 31224969
(3S)-N-ethyl-3-[[4-(thiomorpholin-4-ylmethyl)triazol-1-yl]methyl]piperidine-1-carboxamide (PubChem CID 31224969) has the molecular formula C16H28N6OS and a molecular weight of 352.51 g/mol. Its IUPAC name is (3S)-N-ethyl-3-[[4-(thiomorpholin-4-ylmethyl)triazol-1-yl]methyl]piperidine-1-carboxamide.
| Compound Name | (3S)-N-ethyl-3-[[4-(thiomorpholin-4-ylmethyl)triazol-1-yl]methyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 31224969 |
| Molecular Formula | C16H28N6OS |
| Molecular Weight | 352.51 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | (3S)-N-ethyl-3-[[4-(thiomorpholin-4-ylmethyl)triazol-1-yl]methyl]piperidine-1-carboxamide |
| SMILES | CCNC(=O)N1CCC[C@H](Cn2cc(CN3CCSCC3)nn2)C1 |
| InChI | InChI=1S/C16H28N6OS/c1-2-17-16(23)21-5-3-4-14(10-21)11-22-13-15(18-19-22)12-20-6-8-24-9-7-20/h13-14H,2-12H2,1H3,(H,17,23)/t14-/m0/s1 |
| InChIKey | LRIQKPMXRXSHIX-AWEZNQCLSA-N |
| XLogP | 1.27 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.51 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |