C15H27N5O2S — CID 28767502
1-ethylsulfonyl-4-[[4-(pyrrolidin-1-ylmethyl)triazol-1-yl]methyl]piperidine (PubChem CID 28767502) has the molecular formula C15H27N5O2S and a molecular weight of 341.48 g/mol. Its IUPAC name is 1-ethylsulfonyl-4-[[4-(pyrrolidin-1-ylmethyl)triazol-1-yl]methyl]piperidine.
| Compound Name | 1-ethylsulfonyl-4-[[4-(pyrrolidin-1-ylmethyl)triazol-1-yl]methyl]piperidine |
|---|---|
| PubChem CID | 28767502 |
| Molecular Formula | C15H27N5O2S |
| Molecular Weight | 341.48 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | 1-ethylsulfonyl-4-[[4-(pyrrolidin-1-ylmethyl)triazol-1-yl]methyl]piperidine |
| SMILES | CCS(=O)(=O)N1CCC(Cn2cc(CN3CCCC3)nn2)CC1 |
| InChI | InChI=1S/C15H27N5O2S/c1-2-23(21,22)20-9-5-14(6-10-20)11-19-13-15(16-17-19)12-18-7-3-4-8-18/h13-14H,2-12H2,1H3 |
| InChIKey | CORYBRGGNCUAPQ-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 71.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.48 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |