C9H17N5O2S — CID 129496227
[1-[[(3R)-1-methylsulfonylpyrrolidin-3-yl]methyl]triazol-4-yl]methanamine (PubChem CID 129496227) has the molecular formula C9H17N5O2S and a molecular weight of 259.33 g/mol. Its IUPAC name is [1-[[(3R)-1-methylsulfonylpyrrolidin-3-yl]methyl]triazol-4-yl]methanamine.
| Compound Name | [1-[[(3R)-1-methylsulfonylpyrrolidin-3-yl]methyl]triazol-4-yl]methanamine |
|---|---|
| PubChem CID | 129496227 |
| Molecular Formula | C9H17N5O2S |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | [1-[[(3R)-1-methylsulfonylpyrrolidin-3-yl]methyl]triazol-4-yl]methanamine |
| SMILES | CS(=O)(=O)N1CC[C@H](Cn2cc(CN)nn2)C1 |
| InChI | InChI=1S/C9H17N5O2S/c1-17(15,16)14-3-2-8(6-14)5-13-7-9(4-10)11-12-13/h7-8H,2-6,10H2,1H3/t8-/m1/s1 |
| InChIKey | SVQVEZBSUVWKSH-MRVPVSSYSA-N |
| XLogP | -0.98 |
| TPSA | 94.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |