C15H26N6OS — CID 45242717
[1-[[1-(thian-4-yl)piperidin-3-yl]methyl]triazol-4-yl]methylurea (PubChem CID 45242717) has the molecular formula C15H26N6OS and a molecular weight of 338.48 g/mol. Its IUPAC name is [1-[[1-(thian-4-yl)piperidin-3-yl]methyl]triazol-4-yl]methylurea.
| Compound Name | [1-[[1-(thian-4-yl)piperidin-3-yl]methyl]triazol-4-yl]methylurea |
|---|---|
| PubChem CID | 45242717 |
| Molecular Formula | C15H26N6OS |
| Molecular Weight | 338.48 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | [1-[[1-(thian-4-yl)piperidin-3-yl]methyl]triazol-4-yl]methylurea |
| SMILES | NC(=O)NCc1cn(CC2CCCN(C3CCSCC3)C2)nn1 |
| InChI | InChI=1S/C15H26N6OS/c16-15(22)17-8-13-11-21(19-18-13)10-12-2-1-5-20(9-12)14-3-6-23-7-4-14/h11-12,14H,1-10H2,(H3,16,17,22) |
| InChIKey | BMSRNCYDQILIPM-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 89.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.48 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |