C14H24N6OS2 — CID 29254255
[1-[1-(1,4-dithiepan-6-yl)piperidin-4-yl]triazol-4-yl]methylurea (PubChem CID 29254255) has the molecular formula C14H24N6OS2 and a molecular weight of 356.52 g/mol. Its IUPAC name is [1-[1-(1,4-dithiepan-6-yl)piperidin-4-yl]triazol-4-yl]methylurea.
| Compound Name | [1-[1-(1,4-dithiepan-6-yl)piperidin-4-yl]triazol-4-yl]methylurea |
|---|---|
| PubChem CID | 29254255 |
| Molecular Formula | C14H24N6OS2 |
| Molecular Weight | 356.52 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | [1-[1-(1,4-dithiepan-6-yl)piperidin-4-yl]triazol-4-yl]methylurea |
| SMILES | NC(=O)NCc1cn(C2CCN(C3CSCCSC3)CC2)nn1 |
| InChI | InChI=1S/C14H24N6OS2/c15-14(21)16-7-11-8-20(18-17-11)12-1-3-19(4-2-12)13-9-22-5-6-23-10-13/h8,12-13H,1-7,9-10H2,(H3,15,16,21) |
| InChIKey | CMZWEQSRIQNHKD-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 89.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.52 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |