C19H26FN7O — CID 45245897
[1-[1-[1-(4-fluorophenyl)pyrrolidin-3-yl]piperidin-4-yl]triazol-4-yl]methylurea (PubChem CID 45245897) has the molecular formula C19H26FN7O and a molecular weight of 387.46 g/mol. Its IUPAC name is [1-[1-[1-(4-fluorophenyl)pyrrolidin-3-yl]piperidin-4-yl]triazol-4-yl]methylurea.
| Compound Name | [1-[1-[1-(4-fluorophenyl)pyrrolidin-3-yl]piperidin-4-yl]triazol-4-yl]methylurea |
|---|---|
| PubChem CID | 45245897 |
| Molecular Formula | C19H26FN7O |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | [1-[1-[1-(4-fluorophenyl)pyrrolidin-3-yl]piperidin-4-yl]triazol-4-yl]methylurea |
| SMILES | NC(=O)NCc1cn(C2CCN(C3CCN(c4ccc(F)cc4)C3)CC2)nn1 |
| InChI | InChI=1S/C19H26FN7O/c20-14-1-3-16(4-2-14)26-10-7-18(13-26)25-8-5-17(6-9-25)27-12-15(23-24-27)11-22-19(21)28/h1-4,12,17-18H,5-11,13H2,(H3,21,22,28) |
| InChIKey | AEQMBZZJMVTFBY-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 92.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |