C15H22FN3 — CID 125041821
1-[(3S)-1-(4-fluorophenyl)pyrrolidin-3-yl]-1,4-diazepane (PubChem CID 125041821) has the molecular formula C15H22FN3 and a molecular weight of 263.36 g/mol. Its IUPAC name is 1-[(3S)-1-(4-fluorophenyl)pyrrolidin-3-yl]-1,4-diazepane.
| Compound Name | 1-[(3S)-1-(4-fluorophenyl)pyrrolidin-3-yl]-1,4-diazepane |
|---|---|
| PubChem CID | 125041821 |
| Molecular Formula | C15H22FN3 |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.18 |
| IUPAC Name | 1-[(3S)-1-(4-fluorophenyl)pyrrolidin-3-yl]-1,4-diazepane |
| SMILES | Fc1ccc(N2CC[C@H](N3CCCNCC3)C2)cc1 |
| InChI | InChI=1S/C15H22FN3/c16-13-2-4-14(5-3-13)19-10-6-15(12-19)18-9-1-7-17-8-11-18/h2-5,15,17H,1,6-12H2/t15-/m0/s1 |
| InChIKey | WIRDEYVOVZBSMA-HNNXBMFYSA-N |
| XLogP | 1.70 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |