C22H25FN2O — CID 98640972
[(3S)-1-[(3S)-1-(4-fluorophenyl)pyrrolidin-3-yl]piperidin-3-yl]-phenylmethanone (PubChem CID 98640972) has the molecular formula C22H25FN2O and a molecular weight of 352.45 g/mol. Its IUPAC name is [(3S)-1-[(3S)-1-(4-fluorophenyl)pyrrolidin-3-yl]piperidin-3-yl]-phenylmethanone.
| Compound Name | [(3S)-1-[(3S)-1-(4-fluorophenyl)pyrrolidin-3-yl]piperidin-3-yl]-phenylmethanone |
|---|---|
| PubChem CID | 98640972 |
| Molecular Formula | C22H25FN2O |
| Molecular Weight | 352.45 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | [(3S)-1-[(3S)-1-(4-fluorophenyl)pyrrolidin-3-yl]piperidin-3-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)[C@H]1CCCN([C@H]2CCN(c3ccc(F)cc3)C2)C1 |
| InChI | InChI=1S/C22H25FN2O/c23-19-8-10-20(11-9-19)25-14-12-21(16-25)24-13-4-7-18(15-24)22(26)17-5-2-1-3-6-17/h1-3,5-6,8-11,18,21H,4,7,12-16H2/t18-,21-/m0/s1 |
| InChIKey | KNMIBDHVTIJEQG-RXVVDRJESA-N |
| XLogP | 4.00 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.45 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |