C11H15BrO2S2 — CID 15933127
cyclohex-2-en-1-yl 2-bromo-3,3-bis(methylsulfanyl)prop-2-enoate (PubChem CID 15933127) has the molecular formula C11H15BrO2S2 and a molecular weight of 323.28 g/mol. Its IUPAC name is cyclohex-2-en-1-yl 2-bromo-3,3-bis(methylsulfanyl)prop-2-enoate.
| Compound Name | cyclohex-2-en-1-yl 2-bromo-3,3-bis(methylsulfanyl)prop-2-enoate |
|---|---|
| PubChem CID | 15933127 |
| Molecular Formula | C11H15BrO2S2 |
| Molecular Weight | 323.28 g/mol |
| Exact Mass | 321.97 |
| IUPAC Name | cyclohex-2-en-1-yl 2-bromo-3,3-bis(methylsulfanyl)prop-2-enoate |
| SMILES | CSC(SC)=C(Br)C(=O)OC1C=CCCC1 |
| InChI | InChI=1S/C11H15BrO2S2/c1-15-11(16-2)9(12)10(13)14-8-6-4-3-5-7-8/h4,6,8H,3,5,7H2,1-2H3 |
| InChIKey | SIEZVZWWJKOQFH-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.28 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|