C15H15FN4O6 — CID 159336048
3-[(2R,3S,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]-11-fluoro-3,5,7,9-tetrazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraene-10,12-dione (PubChem CID 159336048) has the molecular formula C15H15FN4O6 and a molecular weight of 366.31 g/mol. Its IUPAC name is 3-[(2R,3S,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]-11-fluoro-3,5,7,9-tetrazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraene-10,12-dione.
| Compound Name | 3-[(2R,3S,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]-11-fluoro-3,5,7,9-tetrazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraene-10,12-dione |
|---|---|
| PubChem CID | 159336048 |
| Molecular Formula | C15H15FN4O6 |
| Molecular Weight | 366.31 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | 3-[(2R,3S,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]-11-fluoro-3,5,7,9-tetrazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraene-10,12-dione |
| SMILES | C[C@]1(O)[C@H](O)[C@@H](CO)O[C@H]1n1cc2c3c(ncnc31)NC(=O)C(F)C2=O |
| InChI | InChI=1S/C15H15FN4O6/c1-15(25)10(23)6(3-21)26-14(15)20-2-5-7-11(17-4-18-12(7)20)19-13(24)8(16)9(5)22/h2,4,6,8,10,14,21,23,25H,3H2,1H3,(H,17,18,19,24)/t6-,8?,10-,14-,15+/m1/s1 |
| InChIKey | LFNVXGCDLXWCDA-HEALQXNKSA-N |
| XLogP | -1.09 |
| TPSA | 146.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.31 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|