About 2-chloro-5-(trifluoromethyl)pyridine;phenylboronic acid;2-phenyl-5-(trifluoromethyl)pyridine
2-chloro-5-(trifluoromethyl)pyridine;phenylboronic acid;2-phenyl-5-(trifluoromethyl)pyridine (PubChem CID 159343495) has the molecular formula C24H18BClF6N2O2
and a molecular weight of 526.67 g/mol. Its IUPAC name is 2-chloro-5-(trifluoromethyl)pyridine;phenylboronic acid;2-phenyl-5-(trifluoromethyl)pyridine.
Molecular Properties
| Compound Name | 2-chloro-5-(trifluoromethyl)pyridine;phenylboronic acid;2-phenyl-5-(trifluoromethyl)pyridine |
| PubChem CID | 159343495 |
| Molecular Formula | C24H18BClF6N2O2 |
| Molecular Weight | 526.67 g/mol |
| Exact Mass | 526.11 |
| IUPAC Name | 2-chloro-5-(trifluoromethyl)pyridine;phenylboronic acid;2-phenyl-5-(trifluoromethyl)pyridine |
| SMILES | FC(F)(F)c1ccc(-c2ccccc2)nc1.FC(F)(F)c1ccc(Cl)nc1.OB(O)c1ccccc1 |
| InChI | InChI=1S/C12H8F3N.C6H7BO2.C6H3ClF3N/c13-12(14,15)10-6-7-11(16-8-10)9-4-2-1-3-5-9;8-7(9)6-4-2-1-3-5-6;7-5-2-1-4(3-11-5)6(8,9)10/h1-8H;1-5,8-9H;1-3H |
| InChIKey | LGKSCJQGMVHRPX-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 526.67 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-5-(trifluoromethyl)pyridine;phenylboronic acid;2-phenyl-5-(trifluoromethyl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-5-(trifluoromethyl)pyridine;phenylboronic acid;2-phenyl-5-(trifluoromethyl)pyridine?
The IUPAC name of 2-chloro-5-(trifluoromethyl)pyridine;phenylboronic acid;2-phenyl-5-(trifluoromethyl)pyridine (CID 159343495) is 2-chloro-5-(trifluoromethyl)pyridine;phenylboronic acid;2-phenyl-5-(trifluoromethyl)pyridine.
What is the SMILES notation for 2-chloro-5-(trifluoromethyl)pyridine;phenylboronic acid;2-phenyl-5-(trifluoromethyl)pyridine?
The canonical SMILES for 2-chloro-5-(trifluoromethyl)pyridine;phenylboronic acid;2-phenyl-5-(trifluoromethyl)pyridine is FC(F)(F)c1ccc(-c2ccccc2)nc1.FC(F)(F)c1ccc(Cl)nc1.OB(O)c1ccccc1.
What is the InChIKey of 2-chloro-5-(trifluoromethyl)pyridine;phenylboronic acid;2-phenyl-5-(trifluoromethyl)pyridine?
The InChIKey is LGKSCJQGMVHRPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8F3N.C6H7BO2.C6H3ClF3N/c13-12(14,15)10-6-7-11(16-8-10)9-4-2-1-3-5-9;8-7(9)6-4-2-1-3-5-6;7-5-2-1-4(3-11-5)6(8,9)10/h1-8H;1-5,8-9H;1-3H.
What are the key properties of 2-chloro-5-(trifluoromethyl)pyridine;phenylboronic acid;2-phenyl-5-(trifluoromethyl)pyridine?
2-chloro-5-(trifluoromethyl)pyridine;phenylboronic acid;2-phenyl-5-(trifluoromethyl)pyridine has a molecular weight of 526.67 g/mol, XLogP of 5.89, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-5-(trifluoromethyl)pyridine;phenylboronic acid;2-phenyl-5-(trifluoromethyl)pyridine is sourced from PubChem (CID 159343495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).