About diethyl 2-[2-(1-methyl-4-pyridinylidene)ethylidene]propanedioate;yttrium
diethyl 2-[2-(1-methyl-4-pyridinylidene)ethylidene]propanedioate;yttrium (PubChem CID 159343897) has the molecular formula C15H19NO4Y
and a molecular weight of 366.23 g/mol. Its IUPAC name is diethyl 2-[2-(1-methyl-4-pyridinylidene)ethylidene]propanedioate;yttrium.
Molecular Properties
| Compound Name | diethyl 2-[2-(1-methyl-4-pyridinylidene)ethylidene]propanedioate;yttrium |
| PubChem CID | 159343897 |
| Molecular Formula | C15H19NO4Y |
| Molecular Weight | 366.23 g/mol |
| Exact Mass | 366.04 |
| IUPAC Name | diethyl 2-[2-(1-methyl-4-pyridinylidene)ethylidene]propanedioate;yttrium |
| SMILES | CCOC(=O)C(=CC=C1C=CN(C)C=C1)C(=O)OCC.[Y] |
| InChI | InChI=1S/C15H19NO4.Y/c1-4-19-14(17)13(15(18)20-5-2)7-6-12-8-10-16(3)11-9-12;/h6-11H,4-5H2,1-3H3; |
| InChIKey | NCGMLFSZKFLUFE-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.23 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze diethyl 2-[2-(1-methyl-4-pyridinylidene)ethylidene]propanedioate;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 2-[2-(1-methyl-4-pyridinylidene)ethylidene]propanedioate;yttrium?
The IUPAC name of diethyl 2-[2-(1-methyl-4-pyridinylidene)ethylidene]propanedioate;yttrium (CID 159343897) is diethyl 2-[2-(1-methyl-4-pyridinylidene)ethylidene]propanedioate;yttrium.
What is the SMILES notation for diethyl 2-[2-(1-methyl-4-pyridinylidene)ethylidene]propanedioate;yttrium?
The canonical SMILES for diethyl 2-[2-(1-methyl-4-pyridinylidene)ethylidene]propanedioate;yttrium is CCOC(=O)C(=CC=C1C=CN(C)C=C1)C(=O)OCC.[Y].
What is the InChIKey of diethyl 2-[2-(1-methyl-4-pyridinylidene)ethylidene]propanedioate;yttrium?
The InChIKey is NCGMLFSZKFLUFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19NO4.Y/c1-4-19-14(17)13(15(18)20-5-2)7-6-12-8-10-16(3)11-9-12;/h6-11H,4-5H2,1-3H3;.
What are the key properties of diethyl 2-[2-(1-methyl-4-pyridinylidene)ethylidene]propanedioate;yttrium?
diethyl 2-[2-(1-methyl-4-pyridinylidene)ethylidene]propanedioate;yttrium has a molecular weight of 366.23 g/mol, XLogP of 1.94, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 2-[2-(1-methyl-4-pyridinylidene)ethylidene]propanedioate;yttrium is sourced from PubChem (CID 159343897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).