C44H37IN4 — CID 159346788
2-(2,6-diphenylphenyl)-1,3-dimethyl-4,5-diphenylimidazol-1-ium;1-phenylimidazole;iodide (PubChem CID 159346788) has the molecular formula C44H37IN4 and a molecular weight of 748.71 g/mol. Its IUPAC name is 2-(2,6-diphenylphenyl)-1,3-dimethyl-4,5-diphenylimidazol-1-ium;1-phenylimidazole;iodide.
| Compound Name | 2-(2,6-diphenylphenyl)-1,3-dimethyl-4,5-diphenylimidazol-1-ium;1-phenylimidazole;iodide |
|---|---|
| PubChem CID | 159346788 |
| Molecular Formula | C44H37IN4 |
| Molecular Weight | 748.71 g/mol |
| Exact Mass | 748.21 |
| IUPAC Name | 2-(2,6-diphenylphenyl)-1,3-dimethyl-4,5-diphenylimidazol-1-ium;1-phenylimidazole;iodide |
| SMILES | Cn1c(-c2ccccc2)c(-c2ccccc2)[n+](C)c1-c1c(-c2ccccc2)cccc1-c1ccccc1.[I-].c1ccc(-n2ccnc2)cc1 |
| InChI | InChI=1S/C35H29N2.C9H8N2.HI/c1-36-33(28-20-11-5-12-21-28)34(29-22-13-6-14-23-29)37(2)35(36)32-30(26-16-7-3-8-17-26)24-15-25-31(32)27-18-9-4-10-19-27;1-2-4-9(5-3-1)11-7-6-10-8-11;/h3-25H,1-2H3;1-8H;1H/q+1;;/p-1 |
| InChIKey | GELWJBSFFSTGSC-UHFFFAOYSA-M |
| XLogP | 7.06 |
| TPSA | 26.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.71 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|